Listing 1 - 3 of 3 |
Sort by
|
Choose an application
Choose an application
Lipoxygenasen. Metabolisme. (Congres) --- Longen. Metabolisme. (Congres) --- Arachidonzuur. Metabolisme. (Congres) --- Prostaglandine. Synthèse. (Congrès) --- Poumons. Métabolisme. (Congrès) --- Acide arachidonique. Métabolisme. (Congrès) --- Lipoxygénases. Métabolisme. (Congrès) --- Prostaglandine. Synthese. (Congres)
Choose an application
Eicosanoic acid --- Leukotrienes --- Arachidonic Acids --- Drug Therapy --- Eicosanoic Acids --- Leukotrienes B --- SRS-A --- Metabolism --- Congresses --- metabolism --- congresses --- Eicosanoic Acides --- Leukotrienes B4 --- Drug Therapy. --- Leukotriene B4 --- 547.295.96 <063> --- -Leukotrienes --- -Slow reacting substance of anaphylaxis --- Eicosanoids --- Arachic acid --- Arachidic acid --- Icosanic acid --- Icosanoic acid --- Unsaturated fatty acids --- Therapy, Drug --- Chemotherapy --- Pharmacotherapy --- Chemotherapies --- Drug Therapies --- Pharmacotherapies --- Therapies, Drug --- Disease --- Pharmaceutical Preparations --- Pharmacologic Actions --- metabolism. --- Eicosoic acids. Arachidic acid CH3(CH2)18COOH--Congressen --- -Congresses --- drug therapy --- therapeutic use --- Congresses. --- congresses. --- -metabolism. --- 547.295.96 <063> Eicosoic acids. Arachidic acid CH3(CH2)18COOH--Congressen --- Arachidonic acids --- Drug therapy --- Eicosanoic acids --- Leukotrienes b --- Srs-a --- -Therapy, Drug --- Slow reacting substance of anaphylaxis --- Metabolism&delete& --- Arachidonic acid --- Arachidonzuur. Metabolisme. (Congres) --- Arachidzuur. Metabolisme. (Congres) --- Leukotrienes. Métabolisme. (Congres) --- Acide arachidonique. Métabolisme. (Congrès) --- Leukotrienes. Metabolisme. (Congres) --- Eicosanoic acid - Metabolism - Congresses --- Leukotrienes - Metabolism - Congresses --- Arachidonic Acids - metabolism - congresses --- Drug Therapy - congresses --- Eicosanoic Acides - metabolism - congresses --- Leukotrienes B4 - metabolism - congresses --- SRS-A - metabolism - congresses
Listing 1 - 3 of 3 |
Sort by
|