Choose an application
Eicosanoic acid --- Leukotrienes --- Arachidonic Acids --- Drug Therapy --- Eicosanoic Acids --- Leukotrienes B --- SRS-A --- Metabolism --- Congresses --- metabolism --- congresses --- Eicosanoic Acides --- Leukotrienes B4 --- Drug Therapy. --- Leukotriene B4 --- 547.295.96 <063> --- -Leukotrienes --- -Slow reacting substance of anaphylaxis --- Eicosanoids --- Arachic acid --- Arachidic acid --- Icosanic acid --- Icosanoic acid --- Unsaturated fatty acids --- Therapy, Drug --- Chemotherapy --- Pharmacotherapy --- Chemotherapies --- Drug Therapies --- Pharmacotherapies --- Therapies, Drug --- Disease --- Pharmaceutical Preparations --- Pharmacologic Actions --- metabolism. --- Eicosoic acids. Arachidic acid CH3(CH2)18COOH--Congressen --- -Congresses --- drug therapy --- therapeutic use --- Congresses. --- congresses. --- -metabolism. --- 547.295.96 <063> Eicosoic acids. Arachidic acid CH3(CH2)18COOH--Congressen --- Arachidonic acids --- Drug therapy --- Eicosanoic acids --- Leukotrienes b --- Srs-a --- -Therapy, Drug --- Slow reacting substance of anaphylaxis --- Metabolism&delete& --- Arachidonic acid --- Arachidonzuur. Metabolisme. (Congres) --- Arachidzuur. Metabolisme. (Congres) --- Leukotrienes. Métabolisme. (Congres) --- Acide arachidonique. Métabolisme. (Congrès) --- Leukotrienes. Metabolisme. (Congres) --- Eicosanoic acid - Metabolism - Congresses --- Leukotrienes - Metabolism - Congresses --- Arachidonic Acids - metabolism - congresses --- Drug Therapy - congresses --- Eicosanoic Acides - metabolism - congresses --- Leukotrienes B4 - metabolism - congresses --- SRS-A - metabolism - congresses
Choose an application
Hearing Loss, Noise-Induced. --- Deafness, Noise induced --- -Noise induced deafness --- Noise induced hearing loss --- Deafness --- Noise --- Congresses --- Physiological effect --- Hearing Loss, Noise-Induced --- Congresses. --- congresses. --- -Congresses --- Deafness [Noise induced ]
Choose an application
Nerfs vaso-moteurs --- Nervous system [Vasomotor ] --- Zenuwstelsel [Vasomotorisch ] --- Arrhythmia, Sinus. --- Heart Rate. --- Psychosomatic Medicine. --- Respiration. --- Somatoform Disorders. --- Arrhythmia --- -Heart --- -Nervous system, Vasomotor --- -Psychophysiology --- -Behavioral physiology --- Physiological psychology --- Physiopsychology --- Psychology, Physiological --- Somatopsychics --- Physiology --- Psychobiology --- Mind and body --- Nervous system, Vasomotor --- Vasomotor nervous system --- Cardiovascular system --- Sympathetic nervous system --- Cardiopulmonary system --- Chest --- Allorhythmia --- Arhythmia --- Arrhythmias --- Cardiac arrhythmia --- Dysrhythmia --- Irregular heart beats --- Heart --- Heart beat --- Electric countershock --- Palpitation --- Briquet Syndrome --- Pain Disorder --- Somatization Disorder --- Somatization Disorders --- Somatoform Disorder --- Syndrome, Briquet --- Breathing --- Lung --- Medicine, Psychosomatic --- Psychophysiology --- Cardiac Chronotropy --- Chronotropism, Cardiac --- Heart Rate Control --- Pulse Rate --- Cardiac Chronotropism --- Chronotropy, Cardiac --- Control, Heart Rate --- Heart Rates --- Pulse Rates --- Rate Control, Heart --- Rate, Heart --- Rate, Pulse --- Rates, Heart --- Rates, Pulse --- Pulse --- Arrhythmia, Sinoatrial --- Sinoatrial Arrhythmia --- Sinus Arrhythmia --- Arrhythmias, Sinoatrial --- Arrhythmias, Sinus --- Sinoatrial Arrhythmias --- Sinus Arrhythmias --- Psychosomatic aspects --- -Congresses --- Innervation --- Congresses --- Diseases --- Vasomotor system --- Arrhythmia, Sinus --- Heart Rate --- Psychosomatic Medicine --- Respiration --- Somatoform Disorders --- congresses. --- Medically Unexplained Syndrome --- Medically Unexplained Syndromes --- Disorder, Somatoform --- Disorders, Somatization --- Disorders, Somatoform --- Syndrome, Medically Unexplained --- Syndromes, Medically Unexplained --- Unexplained Syndrome, Medically --- Unexplained Syndromes, Medically --- Heart Rate Determination --- -Psychosomatic aspects
Choose an application
Reliability (Engineering) --- Fiabilité --- Congresses --- Congrès --- Congresses. --- Fiabilité --- Congrès --- MATHEMATICAL MODELS --- Markov method --- FAULT TREE ANALYSIS --- RISK ANALYSIS --- ERRORS --- RELIABILITY --- Monograph --- Mathematical models. --- Risk assessment. --- Errors. --- Reliability. --- Dependability --- Trustworthiness --- Conduct of life --- Mistakes --- Fallibility --- Analysis, Risk --- Assessment, Risk --- Risk analysis --- Risk evaluation --- Evaluation --- Models, Mathematical --- Simulation methods
Choose an application
Choose an application
Choose an application
Choose an application
Echolocation (Physiology). --- Bioacoustics. --- Animal orientation. --- Cybernetics. --- Systems biology.
Choose an application
Choose an application
Algae. --- Algae --- Economic aspects.